Kiểm tra định kỳ Hóa 12 THPT Nguyễn Khuyến (07-10-2018)

⇒ Tải file đề bài: Download

⇒ Thi online đề này: Vào phòng thi

⇒ Giải chi tiết và đáp án:

1D 2A 3C 4C 5B 6D 7B 8A 9D 10C
11D 12C 13A 14D 15C 16A 17D 18A 19D 20B
21C 22C 23B 24A 25A 26C 27C 28A 29D 30A
31D 32D 33D 34A 35C 36B 37C 38A 39B 40B

Câu 1. Dung dịch chất X tác dụng với nước brom và làm đổi màu quỳ tím. Vậy X là

A. axit axetic.         B. phenol.         C. vinyl axetat.         D. axit acrylic.

Câu 2. Chất X có công thức phân tử C4H6O2. Khi X tác dụng với dung dịch NaOH sinh ra chất Y có công thức phân tử C3H3O2Na. Chất X có tên là

A. metyl acrylat.         B. metyl metacrylat.         C. metyl axetat.         D. etyl acrylat.

Câu 3. Trong phân tử triolein có bao nhiêu liên kết C=O?

A. 6.         B. 2.         C. 3.         D. 4.

Câu 4. Ancol etylic không tác dụng với chất nào sau đây?

A. CuO.         B. O2.         C. KOH.         D. Na.

Câu 5. Cho sơ đồ phản ứng: Thuốc súng không khói ← X → Y → Sobitol. Các hợp chất hữu cơ X, Y lần lượt là

A. tinh bột, glucozơ.         B. xenlulozơ, glucozơ.         C. xenlulozơ, fructozơ.         D. glucozơ, etanol.

(Xem giải) Câu 6. Cho 2,0 gam hỗn hợp X gồm metylamin, đimetylamin phản ứng vừa đủ với 0,05 mol HCl, thu được m gam muối. Giá trị của m là

A. 4,725.         B. 2,550.         C. 3,425.         D. 3,825.

Câu 7. Amin có tên gọi nào sau đây tác dụng với dung dịch HCl tạo ra muối có dạng R-NH3Cl?

A. N-metylmetanamin.         B. isopropylamin.         C. metylphenylamin.         D. trimetylamin.

Câu 8. Chất nào dưới đây không thuộc loại axit béo?

A. (CH3)2CH[CH2]14COOH.         B. CH3[CH2]14COOH.

C. CH3[CH2]16COOH.         D. CH3[CH2]7CH=CH[CH2]7COOH.

(Xem giải) Câu 9. Cho este no, mạch hở có công thức CnHmO6. Quan hệ giữa n với m là

A. m = 2n.         B. m = 2n + 1.         C. m = 2n – 2.         D. m = 2n – 4.

Câu 10. Số nguyên tử hidro có trong một phân tử anilin là

A. 5.         B. 9.         C. 7.         D. 11.

(Xem giải) Câu 11. Số đồng phân cấu tạo amino axit có công thức phân tử C4H9O2N là

A. 3.         B. 2.         C. 4.         D. 5.

Câu 12. Chất nào sau đây không phản ứng với H2 (xúc tác Ni, t°)?

A. Triolein.         B. Glucozơ.         C. Tripanmitin.         D. Vinyl axetat.

Câu 13. Dung dịch chứa chất nào sau đây không làm đổi màu quỳ tím?

A. Axit aminoaxetic.         B. Lysin.         C. Axit glutamic.         D. Metylamin.

Câu 14. Dãy nào say đây gồm các chất được sắp xếp theo thứ tự tăng dần lực bazơ?

A. Amoniac, etylamin, anilin.         B. Anilin, metylamin, amoniac.

C. Etylamin, anilin, amoniac.         D. Anilin, amoniac, metylamin.

(Xem giải) Câu 15. Tổng số chất hữu cơ đơn chức có công thức phân tử C4H8O2 tác dụng với dung dịch NaOH nhưng không tráng bạc là

A. 6.         B. 5.         C. 4.         D. 3.

Bạn đã xem chưa:  [2019] Thi thử THPT Quốc gia trường chuyên KHTN (Lần 2)

(Xem giải) Câu 16. Đốt cháy hoàn toàn 0,25 mol este E tạo bởi axit X và ancol Y. Hấp thụ hết sản phẩm cháy vào nước vôi trong dư thu được 50 gam kết tủa. Tên của ancol Y là

A. ancol metylic.         B. ancol etylic.         C. ancol propylic.         D. ancol anlylic.

Câu 17. Chỉ ra phát biểu đúng.

A. Alanin có công thức C6H5NH2.

B. NH3 là amin làm quỳ tím chuyển sang màu xanh.

C. Đốt cháy cacbohidrat luôn cho mol CO2 bằng mol H2O.

D. Các amino axit thiên nhiên hầu hết là các α-amino axit.

(Xem giải) Câu 18. Xà phòng hóa chất béo X trong NaOH (dư) thu được 18,4 gam glixerol và 182,4 gam một muối natri của axit béo. Tên của X?

A. Triolein.         B. Tripanmitin.         C. Triolein.         D. Tristearin.

(Xem giải) Câu 19. Đốt cháy hoàn toàn 42,48 gam hỗn hợp X gồm glucozơ, fructozơ và xenlulozơ cần dùng 1,44 mol O2. Nếu đun nóng 42,48 gam X trên với dung dịch AgNO3 trong NH3 (dùng dư) thu được lượng Ag là

A. 8,64 gam.         B. 117,04 gam.         C. 86,40 gam.         D. 43,20 gam.

(Xem giải) Câu 20. Đốt cháy hoàn toàn amino axit no, mạch hở X (trong phân tử có một nhóm NH2 và một nhóm COOH), thu được H2O, 5,28 gam CO2 và 0,448 lít N2 (đktc). Công thức phân tử của X là

A. C2H5O2N.         B. C3H7O2N.         C. C4H9O2N.         D. C5H11O2N.

(Xem giải) Câu 21. Để sản xuất 59,4 kg xenlulozơ trinitrat (hiệu suất phản ứng 90%) cần dùng ít nhất V lít dung dịch HNO3 97,67% (D = 1,52 g/ml) phản ứng với lượng dư xenlulozơ. Giá trị của V là

A. 27,23.         B. 27,72.         C. 28,29.         D. 24,95.

(Xem giải) Câu 22. Hợp chất hữu cơ X (C5H11O2N) tác dụng với dung dịch NaOH dư, đun nóng thu được muối natri của α-amino axit và ancol. Số công thức cấu tạo của X là

A. 6.         B. 2.         C. 5.         D. 3.

Câu 23. Kết quả thí nghiệm của các dung dịch X, Y, Z, T với thuốc thử được ghi ở bảng sau:

Mẫu thử Thuốc thử Hiện tượng
X Quỳ tím Chuyển màu đỏ
Y Dung dịch AgNO3 trong NH3 Có kết tủa Ag
Z Dung dịch I2 Có màu xanh tím
T Dung dịch brom Có kết tủa trắng

Các dung dịch X, Y, Z, T lần lượt là

A. Axit glutamic, saccarozơ, hồ tinh bột, anilin.         B. Axit axetic, glucozơ, hồ tinh bột, anilin.

C. Axit glutamic, frutozơ, xenlulozơ, phenol.         D. Axit α-aminopropionic, glucozơ, tinh bột, anilin.

(Xem giải) Câu 24. Một amino axit X chứa 1 nhóm NH2 và 1 nhóm COOH, trong đó oxi chiếm 35,955% khối lượng. Lấy 26,7 gam X cho tác dụng với 200 ml dung dịch NaOH 2M. Cô cạn dung dịch sau phản ứng thu được bao nhiêu gam rắn khan?

A. 37,30 gam.         B. 33,30 gam.         C. 44,40 gam.         D. 36,45 gam.

(Xem giải) Câu 25. Cho các chất: saccarozơ, glucozơ, fructozơ, axit fomic và anđehit axetic. Trong các chất trên, số chất vừa có khả năng tham gia phản ứng tráng bạc vừa có khả năng phản ứng với Cu(OH)2 ở điều kiện thường là

A. 3.         B. 2.         C. 4.         D. 5.

(Xem giải) Câu 26. Trong các chất: phenol, etyl axetat, lysin, saccarozơ. Số chất tác dụng được với dung dịch NaOH, đun nóng là

Bạn đã xem chưa:  Giải chi tiết 36 đề thầy Tào Mạnh Đức (22/36)

A. 4.         B. 1.         C. 3.         D. 2.

(Xem giải) Câu 27. T là hợp chất hữu cơ chỉ chứa một loại nhóm chức, có công thức phân tử C6H10O4. T tác dụng với dung dịch NaOH đun nóng, thu được một ancol X và chất Y có công thức C2H3O2Na. Chất X là

A. ancol etylic.         B. ancol butylic.         C. etylen glicol.         D. propan-1,2-điol.

(Xem giải) Câu 28. Cho 0,25 mol lysin vào 400 ml dung dịch KOH 1M thu được dung dịch X. Dung dịch X phản ứng vừa đủ với a mol HCl. Giá trị của a là

A. 0,9.         B. 0,5.         C. 0,15.         D. 0,65.

(Xem giải) Câu 29. Cho các sơ đồ phản ứng sau:
X + 3NaOH → X1 + X2 + X3 + H2O
X1 + 2NaOH (rắn) → CH4 + 2Na2CO3
X2 + HCl → Phenol + NaCl
X3 + 2AgNO3 + 3NH3 + H2O → CH3COONH4 + 2NH4NO3 + 2Ag.
Công thức phân tử của X là

A. C11H12O5.         B. C10H12O4.         C. C10H8O4.         D. C11H10O4.

(Xem giải) Câu 30. Đốt cháy hoàn toàn hỗn hợp X gồm CH3COOC2H3, C2H5COOCH3 và (CH3COO)3C3H5 cần 17,808 lít O2 (đktc) thu được 30,36 gam CO2 và 10,26 gam H2O. Lượng X trên phản ứng tối đa với bao nhiêu mol NaOH?

A. 0,18.         B. 0,16.         C. 0,12.         D. 0,2.

(Xem giải) Câu 31. Cho các phát biểu sau:
(a) Đốt cháy hoàn toàn triolein, thu được số mol CO2 bằng số mol H2O
(b) Glucozơ bị thủy phân khi có xúc tác axit hoặc enzim.
(c) Thủy phân vinyl fomat, thu được hai sản phẩm đều có phản ứng tráng bạc.
(d) Hợp chất CH3COONH3CH3 là este của aminoaxit.
(e) Chỉ dùng quỳ tím có thể phân biệt ba dung dịch: valin, metylamin, axit glutamic.
(g) Phenylamin tan ít trong nước nhưng tan tốt trong dung dịch NaOH
Số phát biểu đúng là

A. 4.         B. 3.         C. 5.         D. 2.

(Xem giải) Câu 32. Cho các phát biểu sau:
(a) Trong dung dịch, glyxin tồn tại chủ yếu ở dạng ion lưỡng cực
(b) Ở điều kiện thường, etylamin là chất khí, tan nhiều trong nước
(c) Glucozơ và saccarozơ đều có phản ứng tráng bạc
(d) Có hai chất hữu cơ đơn chức, mạch hở có cùng công thức C3H6O2
(e) Tinh bột là đồng phân của xenlulozơ.
(g) Muối phenylamoni clorua không tan trong nước
Số phát biểu đúng là

A. 3.         B. 4.         C. 5.         D. 2.

(Xem giải) Câu 33. Đốt cháy hoàn toàn 0,1 mol hỗn hợp A chứa C2H5OH và một amin X. Sản phẩm thu được dẫn qua bình đựng H2SO4 đặc thấy thoát ra 4,48 lít khí (đktc). Mặt khác, đốt cháy hoàn toàn m gam hỗn hợp A thu được 8,1 gam H2O. Biết sản phẩm của phản ứng cháy gồm CO2, H2O và N2. Giá trị m là.

A. 9,2 gam.         B. 4,6 gam.         C. 3,45 gam.         D. 6,9 gam.

(Xem giải) Câu 34. Hỗn hợp A chứa 2 este X, Y có cùng công thức phân tử C8H8O2, chứa vòng benzen (Y không tham gia phản ứng tráng gương). Cho m gam A tác dụng vừa đủ với dung dịch B chứa NaOH và KOH (tỉ lệ mol tương ứng 3 : 1) đun nóng. Biết tổng số mol các este có trong A nhỏ hơn tổng số mol NaOH và KOH có trong dung dịch B. Sau khi phản ứng xong, thu được dung dịch Z. Cô cạn Z thu được m gam rắn khan. Phần trăm khối lượng của X trong A gần với giá trị nào sau đây:

Bạn đã xem chưa:  Thi thử THPT của trường THPT chuyên Tuyên Quang (Lần 1)

A. 52,2.         B. 51,1.         C. 53,2.         D. 50,0.

(Xem giải) Câu 35. Cho 0,3 mol hỗn hợp X gồm hai este đơn chức tác dụng vừa đủ với 250 ml dung dịch KOH 2M, thu được chất hữu cơ Y (no, đơn chức, mạch hở, có tham gia phản ứng tráng bạc) và 53 gam hỗn hợp muối. Đốt cháy toàn bộ Y cần vừa đủ 5,6 lít khí O2 (đktc). Khối lượng của 0,3 mol X là

A. 29,4 gam.         B. 31,0 gam.         C. 33,0 gam.         D. 41,0 gam.

(Xem giải) Câu 36. Hỗn hợp X chứa metyl acrylat, metylamin, glyxin và 2 hidrocacbon mạch hở. Đốt cháy 0,2 mol X cần vừa đủ x mol O2, thu được 0,48 mol H2O và 1,96 gam N2. Mặt khác, 0,2 mol X tác dụng vừa đủ với 100 ml dung dịch Br2 0,7M, giá trị x gần với giá trị nào sau đây.

A. 0,4.         B. 0,5.         C. 0,7.         D. 0,6.

(Xem giải) Câu 37. Chất hữu cơ mạch hở X có công thức CxHyO4N. Cho m gam X tác dụng với lượng dư dung dịch NaOH, thu được (m + a) gam muối Y của amino axit no, mạch hở và hỗn hợp Z gồm hai ancol. Đốt cháy hoàn toàn một lượng muối Y bất kì, thu được tổng khối lượng CO2 và H2O bằng khối lượng Y. Tổng số nguyên tử trong X là

A. 21.         B. 22.         C. 25.         D. 28.

(Xem giải) Câu 38. Cho 0,1 mol hỗn hợp A gồm hai amino axit X, Y đều no, mạch hở và không có quá 5 nguyên tử oxi trong phân tử. Cho A tác dụng vừa đủ với 100 ml dung dịch H2SO4 0,5M. Mặc khác, cho A tác dụng vừa đủ với 200 ml dung dịch Ba(OH)2 0,3M, cô cạn thu được a gam muối khan. Nếu đốt cháy hoàn toàn hỗn hợp A, cho sản phẩm cháy vào dung dịch Ca(OH)2 dư thu được 26 gam kết tủa. Giá trị của a là

A. 17,04.         B. 18,12.         C. 19,20.         D. 17,16.

(Xem giải) Câu 39. Hỗn hợp A gồm ancol X no, đơn chức, mạch hở, axit Y mạch hở, chứa 2 liên kết π (pi) và este E tạo bởi X và Y. Đốt cháy hoàn toàn m gam A cần 1,344 lít O2 (vừa đủ), thu được 2,016 lít CO2 (các khí đo đktc). Mặt khác, cho m gam A tác dung hết với 100ml dung dịch KOH 0,75M, thu được dung dịch B. Cô cạn B được chất rắn T. Phần trăm khối lượng chất (có khối lượng phân tử nhỏ hơn) trong T gần với giá trị nào sau đây

A. 20%.         B. 15%.         C. 10%.         D. 25%.

(Xem giải) Câu 40. Đốt cháy hoàn toàn hỗn hợp T gồm este hai chức, mạch hở X và este đơn chức Y thu được 6,54 mol CO2 và 3,6 mol H2O. Mặt khác, thủy phân hoàn toàn T cần dụng 141,285 gam dung dịch NaOH 50,96%, cô cạn dung dịch sau phản ứng thu được rắn Q gồm 3 muối (đều có phân tử khối lớn > 90 đvC). Ngưng tụ phần hơi thu được 117,875 ml ancol etylic 40°. Biết khối lượng riêng của ancol etylic nguyên chất bằng 0,8 g/ml và của nước bằng 1 g/ml. Phần trăm khối lượng của muối có phân tử khối nhỏ nhất trong Q là

A. 39,6%.         B. 47,7%.         C. 50,2%.          D. 62,8%.

Bình luận Facebook

1
Bình luận

Mới nhất Cũ nhất Thích nhiều nhất
Mục lục: Thi THPT 2019 – Học Hóa Online

[…] Nguyễn Khuyến (07-10-2018): [Đề thi – Đáp án và giải chi tiết]-[Phòng thi […]

error: Vui lòng không sao chép !!